C19H18F2N6 — CID 162609338
5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-2-imino-3-methanimidoyl-6-(4-methylphenyl)pyrimidin-4-amine (PubChem CID 162609338) has the molecular formula C19H18F2N6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-2-imino-3-methanimidoyl-6-(4-methylphenyl)pyrimidin-4-amine.
| Compound Name | 5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-2-imino-3-methanimidoyl-6-(4-methylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 162609338 |
| Molecular Formula | C19H18F2N6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-2-imino-3-methanimidoyl-6-(4-methylphenyl)pyrimidin-4-amine |
| SMILES | [H]/N=C/n1c(N)c(-c2cc(C)nc(C(F)F)c2)c(-c2ccc(C)cc2)n/c1=N\[H] |
| InChI | InChI=1S/C19H18F2N6/c1-10-3-5-12(6-4-10)16-15(18(23)27(9-22)19(24)26-16)13-7-11(2)25-14(8-13)17(20)21/h3-9,17,22,24H,23H2,1-2H3/b22-9+,24-19+ |
| InChIKey | ZTPJELOPOIGHKK-JUASWVLJSA-N |
| XLogP | 3.68 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|