C17H16F3N7 — CID 168893304
(6Z)-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-4-(4-fluorophenyl)-6-hydrazinylidenepyrimidine-1,2-diamine (PubChem CID 168893304) has the molecular formula C17H16F3N7 and a molecular weight of 375.36 g/mol. Its IUPAC name is (6Z)-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-4-(4-fluorophenyl)-6-hydrazinylidenepyrimidine-1,2-diamine.
| Compound Name | (6Z)-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-4-(4-fluorophenyl)-6-hydrazinylidenepyrimidine-1,2-diamine |
|---|---|
| PubChem CID | 168893304 |
| Molecular Formula | C17H16F3N7 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (6Z)-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-4-(4-fluorophenyl)-6-hydrazinylidenepyrimidine-1,2-diamine |
| SMILES | Cc1cc(-c2c(-c3ccc(F)cc3)nc(N)n(N)/c2=N\N)cc(C(F)F)n1 |
| InChI | InChI=1S/C17H16F3N7/c1-8-6-10(7-12(24-8)15(19)20)13-14(9-2-4-11(18)5-3-9)25-17(21)27(23)16(13)26-22/h2-7,15H,22-23H2,1H3,(H2,21,25)/b26-16- |
| InChIKey | MVKFJQJCWMOLEI-QQXSKIMKSA-N |
| XLogP | 2.07 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|