C18H13F3N2O3S3 — CID 162610684
(5Z)-5-[(4-methylsulfonylphenyl)methylidene]-2-sulfanylidene-3-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3-thiazolidin-4-one (PubChem CID 162610684) has the molecular formula C18H13F3N2O3S3 and a molecular weight of 458.51 g/mol. Its IUPAC name is (5Z)-5-[(4-methylsulfonylphenyl)methylidene]-2-sulfanylidene-3-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-methylsulfonylphenyl)methylidene]-2-sulfanylidene-3-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 162610684 |
| Molecular Formula | C18H13F3N2O3S3 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | (5Z)-5-[(4-methylsulfonylphenyl)methylidene]-2-sulfanylidene-3-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3-thiazolidin-4-one |
| SMILES | CS(=O)(=O)c1ccc(/C=C2\SC(=S)N(Cc3ccc(C(F)(F)F)nc3)C2=O)cc1 |
| InChI | InChI=1S/C18H13F3N2O3S3/c1-29(25,26)13-5-2-11(3-6-13)8-14-16(24)23(17(27)28-14)10-12-4-7-15(22-9-12)18(19,20)21/h2-9H,10H2,1H3/b14-8- |
| InChIKey | HQACFFLZOMRXFT-ZSOIEALJSA-N |
| XLogP | 3.91 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|