C20H22F3N3O2 — CID 162613166
2-[2-(diethylamino)ethylideneamino]-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 162613166) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylideneamino]-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 2-[2-(diethylamino)ethylideneamino]-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 162613166 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[2-(diethylamino)ethylideneamino]-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | CCN(CC)C/C=N/c1ccccc1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3N3O2/c1-3-26(4-2)14-13-24-18-8-6-5-7-17(18)19(27)25-15-9-11-16(12-10-15)28-20(21,22)23/h5-13H,3-4,14H2,1-2H3,(H,25,27)/b24-13+ |
| InChIKey | KFOGESPTJOIIBG-ZMOGYAJESA-N |
| XLogP | 4.88 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|