C23H30F3N3O2 — CID 139470230
2-[[(2R)-5-(diethylamino)pentan-2-yl]amino]-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 139470230) has the molecular formula C23H30F3N3O2 and a molecular weight of 437.51 g/mol. Its IUPAC name is 2-[[(2R)-5-(diethylamino)pentan-2-yl]amino]-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 2-[[(2R)-5-(diethylamino)pentan-2-yl]amino]-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 139470230 |
| Molecular Formula | C23H30F3N3O2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[[(2R)-5-(diethylamino)pentan-2-yl]amino]-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | CCN(CC)CCC[C@@H](C)Nc1ccccc1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H30F3N3O2/c1-4-29(5-2)16-8-9-17(3)27-21-11-7-6-10-20(21)22(30)28-18-12-14-19(15-13-18)31-23(24,25)26/h6-7,10-15,17,27H,4-5,8-9,16H2,1-3H3,(H,28,30)/t17-/m1/s1 |
| InChIKey | GYNKBIZJQNDMGT-QGZVFWFLSA-N |
| XLogP | 5.76 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |