C17H27F2N3OS — CID 7775054
1-[(2S)-5-(diethylamino)pentan-2-yl]-3-[4-(difluoromethoxy)phenyl]thiourea (PubChem CID 7775054) has the molecular formula C17H27F2N3OS and a molecular weight of 359.49 g/mol. Its IUPAC name is 1-[(2S)-5-(diethylamino)pentan-2-yl]-3-[4-(difluoromethoxy)phenyl]thiourea.
| Compound Name | 1-[(2S)-5-(diethylamino)pentan-2-yl]-3-[4-(difluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 7775054 |
| Molecular Formula | C17H27F2N3OS |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[(2S)-5-(diethylamino)pentan-2-yl]-3-[4-(difluoromethoxy)phenyl]thiourea |
| SMILES | CCN(CC)CCC[C@H](C)NC(=S)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H27F2N3OS/c1-4-22(5-2)12-6-7-13(3)20-17(24)21-14-8-10-15(11-9-14)23-16(18)19/h8-11,13,16H,4-7,12H2,1-3H3,(H2,20,21,24)/t13-/m0/s1 |
| InChIKey | YALRSUWNXQHUIK-ZDUSSCGKSA-N |
| XLogP | 4.08 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|