C23H28ClF2N3O3S — CID 162613957
5-chloro-N-(4-cyano-1-bicyclo[3.3.1]nonanyl)-2-[(3,3-difluoro-4-methylpent-4-enyl)sulfonylamino]benzamide (PubChem CID 162613957) has the molecular formula C23H28ClF2N3O3S and a molecular weight of 500.01 g/mol. Its IUPAC name is 5-chloro-N-(4-cyano-1-bicyclo[3.3.1]nonanyl)-2-[(3,3-difluoro-4-methylpent-4-enyl)sulfonylamino]benzamide.
| Compound Name | 5-chloro-N-(4-cyano-1-bicyclo[3.3.1]nonanyl)-2-[(3,3-difluoro-4-methylpent-4-enyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 162613957 |
| Molecular Formula | C23H28ClF2N3O3S |
| Molecular Weight | 500.01 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 5-chloro-N-(4-cyano-1-bicyclo[3.3.1]nonanyl)-2-[(3,3-difluoro-4-methylpent-4-enyl)sulfonylamino]benzamide |
| SMILES | C=C(C)C(F)(F)CCS(=O)(=O)Nc1ccc(Cl)cc1C(=O)NC12CCCC(C1)C(C#N)CC2 |
| InChI | InChI=1S/C23H28ClF2N3O3S/c1-15(2)23(25,26)10-11-33(31,32)29-20-6-5-18(24)12-19(20)21(30)28-22-8-3-4-16(13-22)17(14-27)7-9-22/h5-6,12,16-17,29H,1,3-4,7-11,13H2,2H3,(H,28,30) |
| InChIKey | TVUPGQBFPUUZEZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.01 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|