C24H28F6N2O — CID 162615299
N-[4-[2-[4-(tert-butylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,2-dimethylpropanamide (PubChem CID 162615299) has the molecular formula C24H28F6N2O and a molecular weight of 474.49 g/mol. Its IUPAC name is N-[4-[2-[4-(tert-butylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[2-[4-(tert-butylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 162615299 |
| Molecular Formula | C24H28F6N2O |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | N-[4-[2-[4-(tert-butylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)Nc1ccc(C(c2ccc(NC(=O)C(C)(C)C)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H28F6N2O/c1-20(2,3)19(33)31-17-11-7-15(8-12-17)22(23(25,26)27,24(28,29)30)16-9-13-18(14-10-16)32-21(4,5)6/h7-14,32H,1-6H3,(H,31,33) |
| InChIKey | MHUZYULIMSPORD-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |