C13H20F3N3O — CID 162618530
(2S)-3-[[[(3Z)-hexa-1,3-dien-2-yl]amino]methylideneamino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 162618530) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is (2S)-3-[[[(3Z)-hexa-1,3-dien-2-yl]amino]methylideneamino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | (2S)-3-[[[(3Z)-hexa-1,3-dien-2-yl]amino]methylideneamino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 162618530 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2S)-3-[[[(3Z)-hexa-1,3-dien-2-yl]amino]methylideneamino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | C=C(/C=C\CC)N/C=N/C[C@H](C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C13H20F3N3O/c1-4-5-6-11(3)19-9-17-7-10(2)12(20)18-8-13(14,15)16/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,17,19)(H,18,20)/b6-5-/t10-/m0/s1 |
| InChIKey | OQBVVWCQNSENCM-OMMCCPJFSA-N |
| XLogP | 2.40 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|