C21H28F4N4O2 — CID 162621501
2-methylpropan-2-amine;N-[1-[5-methyl-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide (PubChem CID 162621501) has the molecular formula C21H28F4N4O2 and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-methylpropan-2-amine;N-[1-[5-methyl-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-methylpropan-2-amine;N-[1-[5-methyl-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 162621501 |
| Molecular Formula | C21H28F4N4O2 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 2-methylpropan-2-amine;N-[1-[5-methyl-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
| SMILES | CC(C)(C)N.Cc1cc(C(C)NC(=O)c2ccncc2)cnc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C17H17F4N3O2.C4H11N/c1-10-7-13(8-23-15(10)26-9-17(20,21)16(18)19)11(2)24-14(25)12-3-5-22-6-4-12;1-4(2,3)5/h3-8,11,16H,9H2,1-2H3,(H,24,25);5H2,1-3H3 |
| InChIKey | TWVGSQKDBZXDKB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|