C24H23F2NOS — CID 162623276
4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylaniline (PubChem CID 162623276) has the molecular formula C24H23F2NOS and a molecular weight of 411.52 g/mol. Its IUPAC name is 4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylaniline.
| Compound Name | 4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylaniline |
|---|---|
| PubChem CID | 162623276 |
| Molecular Formula | C24H23F2NOS |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylaniline |
| SMILES | Nc1ccc(S/C(=C\CCc2ccc(OCc3ccccc3)cc2)C(F)F)cc1 |
| InChI | InChI=1S/C24H23F2NOS/c25-24(26)23(29-22-15-11-20(27)12-16-22)8-4-7-18-9-13-21(14-10-18)28-17-19-5-2-1-3-6-19/h1-3,5-6,8-16,24H,4,7,17,27H2/b23-8- |
| InChIKey | PWUHIIBWIZBJLC-NYAPKIOYSA-N |
| XLogP | 6.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|