C19H15F2N2O3S2- — CID 57137069
1-[[5-(4-aminophenyl)sulfanyl-2-(sulfinatoamino)phenyl]methoxy]-2,4-difluorobenzene (PubChem CID 57137069) has the molecular formula C19H15F2N2O3S2- and a molecular weight of 421.47 g/mol. Its IUPAC name is 1-[[5-(4-aminophenyl)sulfanyl-2-(sulfinatoamino)phenyl]methoxy]-2,4-difluorobenzene.
| Compound Name | 1-[[5-(4-aminophenyl)sulfanyl-2-(sulfinatoamino)phenyl]methoxy]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 57137069 |
| Molecular Formula | C19H15F2N2O3S2- |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 1-[[5-(4-aminophenyl)sulfanyl-2-(sulfinatoamino)phenyl]methoxy]-2,4-difluorobenzene |
| SMILES | Nc1ccc(Sc2ccc(NS(=O)[O-])c(COc3ccc(F)cc3F)c2)cc1 |
| InChI | InChI=1S/C19H16F2N2O3S2/c20-13-1-8-19(17(21)10-13)26-11-12-9-16(6-7-18(12)23-28(24)25)27-15-4-2-14(22)3-5-15/h1-10,23H,11,22H2,(H,24,25)/p-1 |
| InChIKey | MQDSCRAVPDNAKX-UHFFFAOYSA-M |
| XLogP | 4.48 |
| TPSA | 87.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|