C11H16F2 — CID 162623317
5,5-difluoropenta-3,4-dienylcyclohexane (PubChem CID 162623317) has the molecular formula C11H16F2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 5,5-difluoropenta-3,4-dienylcyclohexane.
| Compound Name | 5,5-difluoropenta-3,4-dienylcyclohexane |
|---|---|
| PubChem CID | 162623317 |
| Molecular Formula | C11H16F2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 5,5-difluoropenta-3,4-dienylcyclohexane |
| SMILES | FC(F)=C=CCCC1CCCCC1 |
| InChI | InChI=1S/C11H16F2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h5,10H,1-4,6-8H2 |
| InChIKey | JIPUYGSTQISPPA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |