C13H17FN2O — CID 162625169
2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-fluoroaniline (PubChem CID 162625169) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-fluoroaniline.
| Compound Name | 2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-fluoroaniline |
|---|---|
| PubChem CID | 162625169 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-fluoroaniline |
| SMILES | CC(C)(C)[C@H]1COC(c2cc(F)ccc2N)=N1 |
| InChI | InChI=1S/C13H17FN2O/c1-13(2,3)11-7-17-12(16-11)9-6-8(14)4-5-10(9)15/h4-6,11H,7,15H2,1-3H3/t11-/m1/s1 |
| InChIKey | WPLZSVMEKPSRAQ-LLVKDONJSA-N |
| XLogP | 2.60 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|