C19H21N5OS — CID 162625384
4-[[(3aS,6aS)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-2-phenyl-1,3-oxazole (PubChem CID 162625384) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 4-[[(3aS,6aS)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-2-phenyl-1,3-oxazole.
| Compound Name | 4-[[(3aS,6aS)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 162625384 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-[[(3aS,6aS)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-2-phenyl-1,3-oxazole |
| SMILES | Cc1nnc(N2CC[C@H]3[C@@H]2CCN3Cc2coc(-c3ccccc3)n2)s1 |
| InChI | InChI=1S/C19H21N5OS/c1-13-21-22-19(26-13)24-10-8-16-17(24)7-9-23(16)11-15-12-25-18(20-15)14-5-3-2-4-6-14/h2-6,12,16-17H,7-11H2,1H3/t16-,17-/m0/s1 |
| InChIKey | RICKVNRWEKDFJF-IRXDYDNUSA-N |
| XLogP | 3.35 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |