C21H32N2O3S — CID 162625655
1-(4-tert-butylphenyl)sulfonyl-9-propyl-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 162625655) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-9-propyl-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-9-propyl-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 162625655 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-9-propyl-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | CCCN1CCCC2(CCCN2S(=O)(=O)c2ccc(C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C21H32N2O3S/c1-5-14-22-15-6-12-21(19(22)24)13-7-16-23(21)27(25,26)18-10-8-17(9-11-18)20(2,3)4/h8-11H,5-7,12-16H2,1-4H3 |
| InChIKey | DYMCIUNJMNFKIV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |