About methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate
methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate (PubChem CID 162628080) has the molecular formula C14H11N5O3
and a molecular weight of 297.27 g/mol. Its IUPAC name is methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate |
| PubChem CID | 162628080 |
| Molecular Formula | C14H11N5O3 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(NC(=O)c2cnc3cccnn23)c1 |
| InChI | InChI=1S/C14H11N5O3/c1-22-14(21)9-4-6-15-11(7-9)18-13(20)10-8-16-12-3-2-5-17-19(10)12/h2-8H,1H3,(H,15,18,20) |
| InChIKey | LAAULIWXQGAOCB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate?
The IUPAC name of methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate (CID 162628080) is methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate.
What is the SMILES notation for methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate?
The canonical SMILES for methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate is COC(=O)c1ccnc(NC(=O)c2cnc3cccnn23)c1.
What is the InChIKey of methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate?
The InChIKey is LAAULIWXQGAOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N5O3/c1-22-14(21)9-4-6-15-11(7-9)18-13(20)10-8-16-12-3-2-5-17-19(10)12/h2-8H,1H3,(H,15,18,20).
What are the key properties of methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate?
methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate has a molecular weight of 297.27 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(imidazo[1,2-b]pyridazine-3-carbonylamino)pyridine-4-carboxylate is sourced from PubChem (CID 162628080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).