C15H22FN3O2S — CID 162629945
N-[2-[[(2R)-2-amino-3-methyl-3-methylsulfanylbutanoyl]amino]ethyl]-4-fluorobenzamide (PubChem CID 162629945) has the molecular formula C15H22FN3O2S and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[2-[[(2R)-2-amino-3-methyl-3-methylsulfanylbutanoyl]amino]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[[(2R)-2-amino-3-methyl-3-methylsulfanylbutanoyl]amino]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 162629945 |
| Molecular Formula | C15H22FN3O2S |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[2-[[(2R)-2-amino-3-methyl-3-methylsulfanylbutanoyl]amino]ethyl]-4-fluorobenzamide |
| SMILES | CSC(C)(C)[C@H](N)C(=O)NCCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FN3O2S/c1-15(2,22-3)12(17)14(21)19-9-8-18-13(20)10-4-6-11(16)7-5-10/h4-7,12H,8-9,17H2,1-3H3,(H,18,20)(H,19,21)/t12-/m1/s1 |
| InChIKey | PAWBRLGZPNHDLS-GFCCVEGCSA-N |
| XLogP | 1.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|