C17H26FN3OS — CID 162628209
(2R)-2-amino-N-[1-(4-fluorophenyl)piperidin-4-yl]-3-methyl-3-methylsulfanylbutanamide (PubChem CID 162628209) has the molecular formula C17H26FN3OS and a molecular weight of 339.48 g/mol. Its IUPAC name is (2R)-2-amino-N-[1-(4-fluorophenyl)piperidin-4-yl]-3-methyl-3-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-[1-(4-fluorophenyl)piperidin-4-yl]-3-methyl-3-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 162628209 |
| Molecular Formula | C17H26FN3OS |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2R)-2-amino-N-[1-(4-fluorophenyl)piperidin-4-yl]-3-methyl-3-methylsulfanylbutanamide |
| SMILES | CSC(C)(C)[C@H](N)C(=O)NC1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H26FN3OS/c1-17(2,23-3)15(19)16(22)20-13-8-10-21(11-9-13)14-6-4-12(18)5-7-14/h4-7,13,15H,8-11,19H2,1-3H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | KHZFWUMNWMGSRL-OAHLLOKOSA-N |
| XLogP | 2.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |