C24H33FN4O — CID 91255983
2-(4-amino-2,3,5,6-tetramethylanilino)-N-[1-(4-fluorophenyl)piperidin-4-yl]propanamide (PubChem CID 91255983) has the molecular formula C24H33FN4O and a molecular weight of 412.55 g/mol. Its IUPAC name is 2-(4-amino-2,3,5,6-tetramethylanilino)-N-[1-(4-fluorophenyl)piperidin-4-yl]propanamide.
| Compound Name | 2-(4-amino-2,3,5,6-tetramethylanilino)-N-[1-(4-fluorophenyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 91255983 |
| Molecular Formula | C24H33FN4O |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-(4-amino-2,3,5,6-tetramethylanilino)-N-[1-(4-fluorophenyl)piperidin-4-yl]propanamide |
| SMILES | Cc1c(C)c(NC(C)C(=O)NC2CCN(c3ccc(F)cc3)CC2)c(C)c(C)c1N |
| InChI | InChI=1S/C24H33FN4O/c1-14-16(3)23(17(4)15(2)22(14)26)27-18(5)24(30)28-20-10-12-29(13-11-20)21-8-6-19(25)7-9-21/h6-9,18,20,27H,10-13,26H2,1-5H3,(H,28,30) |
| InChIKey | UASCWXAGSLEDPZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|