C31H40N4O2 — CID 90963000
2-(4-amino-2,3,5,6-tetramethylanilino)-N-[1-(4-phenoxyphenyl)piperidin-4-yl]butanamide (PubChem CID 90963000) has the molecular formula C31H40N4O2 and a molecular weight of 500.69 g/mol. Its IUPAC name is 2-(4-amino-2,3,5,6-tetramethylanilino)-N-[1-(4-phenoxyphenyl)piperidin-4-yl]butanamide.
| Compound Name | 2-(4-amino-2,3,5,6-tetramethylanilino)-N-[1-(4-phenoxyphenyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 90963000 |
| Molecular Formula | C31H40N4O2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 2-(4-amino-2,3,5,6-tetramethylanilino)-N-[1-(4-phenoxyphenyl)piperidin-4-yl]butanamide |
| SMILES | CCC(Nc1c(C)c(C)c(N)c(C)c1C)C(=O)NC1CCN(c2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C31H40N4O2/c1-6-28(34-30-22(4)20(2)29(32)21(3)23(30)5)31(36)33-24-16-18-35(19-17-24)25-12-14-27(15-13-25)37-26-10-8-7-9-11-26/h7-15,24,28,34H,6,16-19,32H2,1-5H3,(H,33,36) |
| InChIKey | PTYLWVMDTIYFFK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|