C18H23N5O2S — CID 162630320
3-[3-pentyl-5-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1,2,4-triazol-1-yl]thiolane 1,1-dioxide (PubChem CID 162630320) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-[3-pentyl-5-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1,2,4-triazol-1-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[3-pentyl-5-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1,2,4-triazol-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 162630320 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-[3-pentyl-5-(1H-pyrrolo[2,3-b]pyridin-6-yl)-1,2,4-triazol-1-yl]thiolane 1,1-dioxide |
| SMILES | CCCCCc1nc(-c2ccc3cc[nH]c3n2)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C18H23N5O2S/c1-2-3-4-5-16-21-18(15-7-6-13-8-10-19-17(13)20-15)23(22-16)14-9-11-26(24,25)12-14/h6-8,10,14H,2-5,9,11-12H2,1H3,(H,19,20) |
| InChIKey | PKMABZGFSQUKOM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|