C16H23N5O3S — CID 97188558
(3S)-3-[3-(ethoxymethyl)-5-(4,5,6,7-tetrahydro-1H-indazol-3-yl)-1,2,4-triazol-1-yl]thiolane 1,1-dioxide (PubChem CID 97188558) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is (3S)-3-[3-(ethoxymethyl)-5-(4,5,6,7-tetrahydro-1H-indazol-3-yl)-1,2,4-triazol-1-yl]thiolane 1,1-dioxide.
| Compound Name | (3S)-3-[3-(ethoxymethyl)-5-(4,5,6,7-tetrahydro-1H-indazol-3-yl)-1,2,4-triazol-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 97188558 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (3S)-3-[3-(ethoxymethyl)-5-(4,5,6,7-tetrahydro-1H-indazol-3-yl)-1,2,4-triazol-1-yl]thiolane 1,1-dioxide |
| SMILES | CCOCc1nc(-c2n[nH]c3c2CCCC3)n([C@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C16H23N5O3S/c1-2-24-9-14-17-16(15-12-5-3-4-6-13(12)18-19-15)21(20-14)11-7-8-25(22,23)10-11/h11H,2-10H2,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | YZLNQMUOBOKTTL-NSHDSACASA-N |
| XLogP | 1.44 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |