C26H38N4O4 — CID 162631686
10-acetyl-7-(3-methylbutyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione (PubChem CID 162631686) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 10-acetyl-7-(3-methylbutyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione.
| Compound Name | 10-acetyl-7-(3-methylbutyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione |
|---|---|
| PubChem CID | 162631686 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 10-acetyl-7-(3-methylbutyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione |
| SMILES | CC(=O)N1CCCCNC(=O)C2(CCCc3ccccc32)NC(=O)CN(CCC(C)C)C(=O)C1 |
| InChI | InChI=1S/C26H38N4O4/c1-19(2)12-16-30-17-23(32)28-26(13-8-10-21-9-4-5-11-22(21)26)25(34)27-14-6-7-15-29(20(3)31)18-24(30)33/h4-5,9,11,19H,6-8,10,12-18H2,1-3H3,(H,27,34)(H,28,32) |
| InChIKey | VORVPRUMJHMPAO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |