C30H40ClN5O3 — CID 162631761
10-[(3-chloro-4-pyridinyl)methyl]-7-(3-methylbutyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione (PubChem CID 162631761) has the molecular formula C30H40ClN5O3 and a molecular weight of 554.14 g/mol. Its IUPAC name is 10-[(3-chloro-4-pyridinyl)methyl]-7-(3-methylbutyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione.
| Compound Name | 10-[(3-chloro-4-pyridinyl)methyl]-7-(3-methylbutyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione |
|---|---|
| PubChem CID | 162631761 |
| Molecular Formula | C30H40ClN5O3 |
| Molecular Weight | 554.14 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 10-[(3-chloro-4-pyridinyl)methyl]-7-(3-methylbutyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione |
| SMILES | CC(C)CCN1CC(=O)NC2(CCCc3ccccc32)C(=O)NCCCCN(Cc2ccncc2Cl)CC1=O |
| InChI | InChI=1S/C30H40ClN5O3/c1-22(2)12-17-36-20-27(37)34-30(13-7-9-23-8-3-4-10-25(23)30)29(39)33-14-5-6-16-35(21-28(36)38)19-24-11-15-32-18-26(24)31/h3-4,8,10-11,15,18,22H,5-7,9,12-14,16-17,19-21H2,1-2H3,(H,33,39)(H,34,37) |
| InChIKey | ZXFXLZIQQZLTPU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |