C33H42N4O4 — CID 171156698
7-(3-methylbutyl)-10-(3-phenylprop-2-enoyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione (PubChem CID 171156698) has the molecular formula C33H42N4O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is 7-(3-methylbutyl)-10-(3-phenylprop-2-enoyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione.
| Compound Name | 7-(3-methylbutyl)-10-(3-phenylprop-2-enoyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione |
|---|---|
| PubChem CID | 171156698 |
| Molecular Formula | C33H42N4O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 7-(3-methylbutyl)-10-(3-phenylprop-2-enoyl)spiro[1,4,7,10-tetrazacyclotetradecane-3,4'-2,3-dihydro-1H-naphthalene]-2,5,8-trione |
| SMILES | CC(C)CCN1CC(=O)NC2(CCCc3ccccc32)C(=O)NCCCCN(C(=O)C=Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C33H42N4O4/c1-25(2)18-22-37-23-29(38)35-33(19-10-14-27-13-6-7-15-28(27)33)32(41)34-20-8-9-21-36(24-31(37)40)30(39)17-16-26-11-4-3-5-12-26/h3-7,11-13,15-17,25H,8-10,14,18-24H2,1-2H3,(H,34,41)(H,35,38) |
| InChIKey | PPTYOCFPJLZKOR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|