C15H14ClN3O2 — CID 162638953
(3aS,6aS)-5-(3-chloro-1H-indole-2-carbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one (PubChem CID 162638953) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is (3aS,6aS)-5-(3-chloro-1H-indole-2-carbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one.
| Compound Name | (3aS,6aS)-5-(3-chloro-1H-indole-2-carbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 162638953 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (3aS,6aS)-5-(3-chloro-1H-indole-2-carbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
| SMILES | O=C1NC[C@H]2CN(C(=O)c3[nH]c4ccccc4c3Cl)C[C@@H]12 |
| InChI | InChI=1S/C15H14ClN3O2/c16-12-9-3-1-2-4-11(9)18-13(12)15(21)19-6-8-5-17-14(20)10(8)7-19/h1-4,8,10,18H,5-7H2,(H,17,20)/t8-,10+/m0/s1 |
| InChIKey | GBHSQHDZZDQKFZ-WCBMZHEXSA-N |
| XLogP | 1.64 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |