C17H33N3OS — CID 162640089
4-[2-(dimethylamino)ethyl]-8-hexyl-1-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 162640089) has the molecular formula C17H33N3OS and a molecular weight of 327.54 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]-8-hexyl-1-thia-4,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 4-[2-(dimethylamino)ethyl]-8-hexyl-1-thia-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 162640089 |
| Molecular Formula | C17H33N3OS |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]-8-hexyl-1-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CCCCCCN1CCC2(CC1)SCC(=O)N2CCN(C)C |
| InChI | InChI=1S/C17H33N3OS/c1-4-5-6-7-10-19-11-8-17(9-12-19)20(14-13-18(2)3)16(21)15-22-17/h4-15H2,1-3H3 |
| InChIKey | YECOAWNUMTYPMC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|