C15H28N2OS — CID 58245198
4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 58245198) has the molecular formula C15H28N2OS and a molecular weight of 284.47 g/mol. Its IUPAC name is 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 58245198 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CC(C)(C)N1CCC2(CC1)SCC(=O)N2C(C)(C)C |
| InChI | InChI=1S/C15H28N2OS/c1-13(2,3)16-9-7-15(8-10-16)17(14(4,5)6)12(18)11-19-15/h7-11H2,1-6H3 |
| InChIKey | ORQBNBNBNUEURJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |