C10H18N2OS — CID 22097452
2,4,8-trimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 22097452) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is 2,4,8-trimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2,4,8-trimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 22097452 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2,4,8-trimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CC1SC2(CCN(C)CC2)N(C)C1=O |
| InChI | InChI=1S/C10H18N2OS/c1-8-9(13)12(3)10(14-8)4-6-11(2)7-5-10/h8H,4-7H2,1-3H3 |
| InChIKey | RLYDPSYBQXOROH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |