About triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate
triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate (PubChem CID 162640109) has the molecular formula C17H25NO4Sn
and a molecular weight of 426.10 g/mol. Its IUPAC name is triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate |
| PubChem CID | 162640109 |
| Molecular Formula | C17H25NO4Sn |
| Molecular Weight | 426.10 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate |
| SMILES | CC[Sn](CC)(CC)OC(=O)/C=C/C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C11H11NO4.3C2H5.Sn/c1-16-9-5-3-2-4-8(9)12-10(13)6-7-11(14)15;3*1-2;/h2-7H,1H3,(H,12,13)(H,14,15);3*1H2,2H3;/q;;;;+1/p-1/b7-6+;;;; |
| InChIKey | MHQJPEGXIQNODO-MNPOOLNOSA-M |
| XLogP | 3.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.10 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate?
The IUPAC name of triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate (CID 162640109) is triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate.
What is the SMILES notation for triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate?
The canonical SMILES for triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate is CC[Sn](CC)(CC)OC(=O)/C=C/C(=O)Nc1ccccc1OC.
What is the InChIKey of triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate?
The InChIKey is MHQJPEGXIQNODO-MNPOOLNOSA-M. The full InChI is InChI=1S/C11H11NO4.3C2H5.Sn/c1-16-9-5-3-2-4-8(9)12-10(13)6-7-11(14)15;3*1-2;/h2-7H,1H3,(H,12,13)(H,14,15);3*1H2,2H3;/q;;;;+1/p-1/b7-6+;;;;.
What are the key properties of triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate?
triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate has a molecular weight of 426.10 g/mol, XLogP of 3.74, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triethylstannyl (E)-4-(2-methoxyanilino)-4-oxobut-2-enoate is sourced from PubChem (CID 162640109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).