C12H19NO3 — CID 162640517
4-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenol (PubChem CID 162640517) has the molecular formula C12H19NO3 and a molecular weight of 232.33 g/mol. Its IUPAC name is 4-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenol.
| Compound Name | 4-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenol |
|---|---|
| PubChem CID | 162640517 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 4-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenol |
| SMILES | [2H]C([2H])([2H])C([2H])(NC[C@H](O)COc1ccc(O)cc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C12H19NO3/c1-9(2)13-7-11(15)8-16-12-5-3-10(14)4-6-12/h3-6,9,11,13-15H,7-8H2,1-2H3/t11-/m0/s1/i1D3,2D3,9D |
| InChIKey | ADUKCCWBEDSMEB-PKPOXZPGSA-N |
| XLogP | 1.13 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |