C16H26N2O2 — CID 171394853
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yliminomethyl)phenoxy]propan-2-ol (PubChem CID 171394853) has the molecular formula C16H26N2O2 and a molecular weight of 292.48 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yliminomethyl)phenoxy]propan-2-ol.
| Compound Name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yliminomethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 171394853 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 292.48 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yliminomethyl)phenoxy]propan-2-ol |
| SMILES | [2H]C([2H])([2H])C([2H])(/N=C/c1ccc(OCC(O)CNC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])cc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C16H26N2O2/c1-12(2)17-9-14-5-7-16(8-6-14)20-11-15(19)10-18-13(3)4/h5-9,12-13,15,18-19H,10-11H2,1-4H3/b17-9+/i1D3,2D3,3D3,4D3,12D,13D |
| InChIKey | ZLXMAHMMDOCLOI-IBYNSCGNSA-N |
| XLogP | 2.25 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|