C8H18O5 — CID 162642367
1,1,2,2-tetradeuterio-2-[2-[2-(1,1,2,2-tetradeuterio-2-hydroxyethoxy)ethoxy]ethoxy]ethanol (PubChem CID 162642367) has the molecular formula C8H18O5 and a molecular weight of 202.28 g/mol. Its IUPAC name is 1,1,2,2-tetradeuterio-2-[2-[2-(1,1,2,2-tetradeuterio-2-hydroxyethoxy)ethoxy]ethoxy]ethanol.
| Compound Name | 1,1,2,2-tetradeuterio-2-[2-[2-(1,1,2,2-tetradeuterio-2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 162642367 |
| Molecular Formula | C8H18O5 |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1,1,2,2-tetradeuterio-2-[2-[2-(1,1,2,2-tetradeuterio-2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
| SMILES | [2H]C([2H])(O)C([2H])([2H])OCCOCCOC([2H])([2H])C([2H])([2H])O |
| InChI | InChI=1S/C8H18O5/c9-1-3-11-5-7-13-8-6-12-4-2-10/h9-10H,1-8H2/i1D2,2D2,3D2,4D2 |
| InChIKey | UWHCKJMYHZGTIT-SVYQBANQSA-N |
| XLogP | -0.98 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|