C4H8O4 — CID 123752964
(1,1,2,2-tetradeuterio-2-hydroxyethyl) 2,2-dideuterioethaneperoxoate (PubChem CID 123752964) has the molecular formula C4H8O4 and a molecular weight of 126.14 g/mol. Its IUPAC name is (1,1,2,2-tetradeuterio-2-hydroxyethyl) 2,2-dideuterioethaneperoxoate.
| Compound Name | (1,1,2,2-tetradeuterio-2-hydroxyethyl) 2,2-dideuterioethaneperoxoate |
|---|---|
| PubChem CID | 123752964 |
| Molecular Formula | C4H8O4 |
| Molecular Weight | 126.14 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (1,1,2,2-tetradeuterio-2-hydroxyethyl) 2,2-dideuterioethaneperoxoate |
| SMILES | [2H]C([2H])C(=O)OOC([2H])([2H])C([2H])([2H])O |
| InChI | InChI=1S/C4H8O4/c1-4(6)8-7-3-2-5/h5H,2-3H2,1H3/i1D2,2D2,3D2 |
| InChIKey | QVQDFOPHFATLEO-NMFSSPJFSA-N |
| XLogP | -0.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.14 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|