C21H15N3O4 — CID 162643011
4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide (PubChem CID 162643011) has the molecular formula C21H15N3O4 and a molecular weight of 373.37 g/mol. Its IUPAC name is 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide.
| Compound Name | 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide |
|---|---|
| PubChem CID | 162643011 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)c3ccncc3C2=O)cc1-c1ccccc1 |
| InChI | InChI=1S/C21H15N3O4/c25-19(23-28)15-7-6-13(10-17(15)14-4-2-1-3-5-14)12-24-20(26)16-8-9-22-11-18(16)21(24)27/h1-11,28H,12H2,(H,23,25) |
| InChIKey | IQPWCCOIBLQJFA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|