About 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide
4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide (PubChem CID 162643011) has the molecular formula C21H15N3O4
and a molecular weight of 373.37 g/mol. Its IUPAC name is 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide.
Molecular Properties
| Compound Name | 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide |
| PubChem CID | 162643011 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)c3ccncc3C2=O)cc1-c1ccccc1 |
| InChI | InChI=1S/C21H15N3O4/c25-19(23-28)15-7-6-13(10-17(15)14-4-2-1-3-5-14)12-24-20(26)16-8-9-22-11-18(16)21(24)27/h1-11,28H,12H2,(H,23,25) |
| InChIKey | IQPWCCOIBLQJFA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide?
The IUPAC name of 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide (CID 162643011) is 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide.
What is the SMILES notation for 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide?
The canonical SMILES for 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide is O=C(NO)c1ccc(CN2C(=O)c3ccncc3C2=O)cc1-c1ccccc1.
What is the InChIKey of 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide?
The InChIKey is IQPWCCOIBLQJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N3O4/c25-19(23-28)15-7-6-13(10-17(15)14-4-2-1-3-5-14)12-24-20(26)16-8-9-22-11-18(16)21(24)27/h1-11,28H,12H2,(H,23,25).
What are the key properties of 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide?
4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide has a molecular weight of 373.37 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)methyl]-N-hydroxy-2-phenylbenzamide is sourced from PubChem (CID 162643011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).