About 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide
4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide (PubChem CID 162644854) has the molecular formula C20H18Cl2N2O3S
and a molecular weight of 437.35 g/mol. Its IUPAC name is 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide |
| PubChem CID | 162644854 |
| Molecular Formula | C20H18Cl2N2O3S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide |
| SMILES | CCC(=O)c1cc(-c2ccc(Cl)cc2Cl)n(-c2ccc(S(N)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C20H18Cl2N2O3S/c1-3-20(25)17-11-19(16-9-4-13(21)10-18(16)22)24(12(17)2)14-5-7-15(8-6-14)28(23,26)27/h4-11H,3H2,1-2H3,(H2,23,26,27) |
| InChIKey | XQBDFJMVGYKEDH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide?
The IUPAC name of 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide (CID 162644854) is 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide.
What is the SMILES notation for 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide?
The canonical SMILES for 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide is CCC(=O)c1cc(-c2ccc(Cl)cc2Cl)n(-c2ccc(S(N)(=O)=O)cc2)c1C.
What is the InChIKey of 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide?
The InChIKey is XQBDFJMVGYKEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18Cl2N2O3S/c1-3-20(25)17-11-19(16-9-4-13(21)10-18(16)22)24(12(17)2)14-5-7-15(8-6-14)28(23,26)27/h4-11H,3H2,1-2H3,(H2,23,26,27).
What are the key properties of 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide?
4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide has a molecular weight of 437.35 g/mol, XLogP of 5.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2,4-dichlorophenyl)-2-methyl-3-propanoylpyrrol-1-yl]benzenesulfonamide is sourced from PubChem (CID 162644854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).