C25H20Cl2N2O3S — CID 24895834
4-[3-(4-chloro-3-methylbenzoyl)-5-(4-chlorophenyl)-2-methylpyrrol-1-yl]benzenesulfonamide (PubChem CID 24895834) has the molecular formula C25H20Cl2N2O3S and a molecular weight of 499.42 g/mol. Its IUPAC name is 4-[3-(4-chloro-3-methylbenzoyl)-5-(4-chlorophenyl)-2-methylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-(4-chloro-3-methylbenzoyl)-5-(4-chlorophenyl)-2-methylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 24895834 |
| Molecular Formula | C25H20Cl2N2O3S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | 4-[3-(4-chloro-3-methylbenzoyl)-5-(4-chlorophenyl)-2-methylpyrrol-1-yl]benzenesulfonamide |
| SMILES | Cc1cc(C(=O)c2cc(-c3ccc(Cl)cc3)n(-c3ccc(S(N)(=O)=O)cc3)c2C)ccc1Cl |
| InChI | InChI=1S/C25H20Cl2N2O3S/c1-15-13-18(5-12-23(15)27)25(30)22-14-24(17-3-6-19(26)7-4-17)29(16(22)2)20-8-10-21(11-9-20)33(28,31)32/h3-14H,1-2H3,(H2,28,31,32) |
| InChIKey | MACADHNVLDEWFB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|