C20H19ClN4O3S — CID 162645378
5-[6-chloro-5-[(2,4-dimethylphenyl)sulfonylamino]-3-pyridinyl]-N-methylpyridine-3-carboxamide (PubChem CID 162645378) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is 5-[6-chloro-5-[(2,4-dimethylphenyl)sulfonylamino]-3-pyridinyl]-N-methylpyridine-3-carboxamide.
| Compound Name | 5-[6-chloro-5-[(2,4-dimethylphenyl)sulfonylamino]-3-pyridinyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 162645378 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 5-[6-chloro-5-[(2,4-dimethylphenyl)sulfonylamino]-3-pyridinyl]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cncc(-c2cnc(Cl)c(NS(=O)(=O)c3ccc(C)cc3C)c2)c1 |
| InChI | InChI=1S/C20H19ClN4O3S/c1-12-4-5-18(13(2)6-12)29(27,28)25-17-8-15(11-24-19(17)21)14-7-16(10-23-9-14)20(26)22-3/h4-11,25H,1-3H3,(H,22,26) |
| InChIKey | BJPBQWZDHYOSEU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|