C24H19ClN4O3S — CID 162647933
5-[6-chloro-5-[(4-phenylphenyl)sulfonylamino]-3-pyridinyl]-N-methylpyridine-3-carboxamide (PubChem CID 162647933) has the molecular formula C24H19ClN4O3S and a molecular weight of 478.96 g/mol. Its IUPAC name is 5-[6-chloro-5-[(4-phenylphenyl)sulfonylamino]-3-pyridinyl]-N-methylpyridine-3-carboxamide.
| Compound Name | 5-[6-chloro-5-[(4-phenylphenyl)sulfonylamino]-3-pyridinyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 162647933 |
| Molecular Formula | C24H19ClN4O3S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 5-[6-chloro-5-[(4-phenylphenyl)sulfonylamino]-3-pyridinyl]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cncc(-c2cnc(Cl)c(NS(=O)(=O)c3ccc(-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C24H19ClN4O3S/c1-26-24(30)20-11-18(13-27-14-20)19-12-22(23(25)28-15-19)29-33(31,32)21-9-7-17(8-10-21)16-5-3-2-4-6-16/h2-15,29H,1H3,(H,26,30) |
| InChIKey | AOYINAMDTZPCNI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|