C20H17ClN4O4S — CID 162645308
5-[6-chloro-5-(2,3-dihydro-1-benzofuran-5-ylsulfonylamino)-3-pyridinyl]-N-methylpyridine-3-carboxamide (PubChem CID 162645308) has the molecular formula C20H17ClN4O4S and a molecular weight of 444.90 g/mol. Its IUPAC name is 5-[6-chloro-5-(2,3-dihydro-1-benzofuran-5-ylsulfonylamino)-3-pyridinyl]-N-methylpyridine-3-carboxamide.
| Compound Name | 5-[6-chloro-5-(2,3-dihydro-1-benzofuran-5-ylsulfonylamino)-3-pyridinyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 162645308 |
| Molecular Formula | C20H17ClN4O4S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 5-[6-chloro-5-(2,3-dihydro-1-benzofuran-5-ylsulfonylamino)-3-pyridinyl]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cncc(-c2cnc(Cl)c(NS(=O)(=O)c3ccc4c(c3)CCO4)c2)c1 |
| InChI | InChI=1S/C20H17ClN4O4S/c1-22-20(26)15-6-13(9-23-10-15)14-8-17(19(21)24-11-14)25-30(27,28)16-2-3-18-12(7-16)4-5-29-18/h2-3,6-11,25H,4-5H2,1H3,(H,22,26) |
| InChIKey | IKFOPLMCUBZYDF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|