C25H18ClN3O4S — CID 71556566
N-[2-chloro-5-(5-phenylfuro[2,3-b]pyridin-3-yl)-3-pyridinyl]-4-methoxybenzenesulfonamide (PubChem CID 71556566) has the molecular formula C25H18ClN3O4S and a molecular weight of 491.96 g/mol. Its IUPAC name is N-[2-chloro-5-(5-phenylfuro[2,3-b]pyridin-3-yl)-3-pyridinyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-chloro-5-(5-phenylfuro[2,3-b]pyridin-3-yl)-3-pyridinyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 71556566 |
| Molecular Formula | C25H18ClN3O4S |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | N-[2-chloro-5-(5-phenylfuro[2,3-b]pyridin-3-yl)-3-pyridinyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(-c3coc4ncc(-c5ccccc5)cc34)cnc2Cl)cc1 |
| InChI | InChI=1S/C25H18ClN3O4S/c1-32-19-7-9-20(10-8-19)34(30,31)29-23-12-18(14-27-24(23)26)22-15-33-25-21(22)11-17(13-28-25)16-5-3-2-4-6-16/h2-15,29H,1H3 |
| InChIKey | ICZVAPAZQCEKQO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|