C26H19ClN6O3S — CID 25144376
N-[6-[5-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-pyridin-4-ylquinazolin-2-yl]acetamide (PubChem CID 25144376) has the molecular formula C26H19ClN6O3S and a molecular weight of 531.00 g/mol. Its IUPAC name is N-[6-[5-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-pyridin-4-ylquinazolin-2-yl]acetamide.
| Compound Name | N-[6-[5-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-pyridin-4-ylquinazolin-2-yl]acetamide |
|---|---|
| PubChem CID | 25144376 |
| Molecular Formula | C26H19ClN6O3S |
| Molecular Weight | 531.00 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | N-[6-[5-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-pyridin-4-ylquinazolin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(-c2ccncc2)c2cc(-c3cnc(Cl)c(NS(=O)(=O)c4ccccc4)c3)ccc2n1 |
| InChI | InChI=1S/C26H19ClN6O3S/c1-16(34)30-26-31-22-8-7-18(13-21(22)24(32-26)17-9-11-28-12-10-17)19-14-23(25(27)29-15-19)33-37(35,36)20-5-3-2-4-6-20/h2-15,33H,1H3,(H,30,31,32,34) |
| InChIKey | CRYOEDNNWYHLCC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.00 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|