C14H8F3NO4S — CID 162646445
6-[4-(trifluoromethoxy)phenyl]oxathiino[6,5-b]pyridine 2,2-dioxide (PubChem CID 162646445) has the molecular formula C14H8F3NO4S and a molecular weight of 343.28 g/mol. Its IUPAC name is 6-[4-(trifluoromethoxy)phenyl]oxathiino[6,5-b]pyridine 2,2-dioxide.
| Compound Name | 6-[4-(trifluoromethoxy)phenyl]oxathiino[6,5-b]pyridine 2,2-dioxide |
|---|---|
| PubChem CID | 162646445 |
| Molecular Formula | C14H8F3NO4S |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 6-[4-(trifluoromethoxy)phenyl]oxathiino[6,5-b]pyridine 2,2-dioxide |
| SMILES | O=S1(=O)C=Cc2cc(-c3ccc(OC(F)(F)F)cc3)cnc2O1 |
| InChI | InChI=1S/C14H8F3NO4S/c15-14(16,17)21-12-3-1-9(2-4-12)11-7-10-5-6-23(19,20)22-13(10)18-8-11/h1-8H |
| InChIKey | WTWOOTOUPJQVDE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|