C14H8F3NO3S — CID 162650591
6-[4-(trifluoromethyl)phenyl]oxathiino[6,5-b]pyridine 2,2-dioxide (PubChem CID 162650591) has the molecular formula C14H8F3NO3S and a molecular weight of 327.28 g/mol. Its IUPAC name is 6-[4-(trifluoromethyl)phenyl]oxathiino[6,5-b]pyridine 2,2-dioxide.
| Compound Name | 6-[4-(trifluoromethyl)phenyl]oxathiino[6,5-b]pyridine 2,2-dioxide |
|---|---|
| PubChem CID | 162650591 |
| Molecular Formula | C14H8F3NO3S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 6-[4-(trifluoromethyl)phenyl]oxathiino[6,5-b]pyridine 2,2-dioxide |
| SMILES | O=S1(=O)C=Cc2cc(-c3ccc(C(F)(F)F)cc3)cnc2O1 |
| InChI | InChI=1S/C14H8F3NO3S/c15-14(16,17)12-3-1-9(2-4-12)11-7-10-5-6-22(19,20)21-13(10)18-8-11/h1-8H |
| InChIKey | WLXAVZGEPMKPOR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|