C20H26N2O — CID 162647169
4-[2-[(4R)-7-methoxy-4-methyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]ethyl]aniline (PubChem CID 162647169) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-[2-[(4R)-7-methoxy-4-methyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]ethyl]aniline.
| Compound Name | 4-[2-[(4R)-7-methoxy-4-methyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]ethyl]aniline |
|---|---|
| PubChem CID | 162647169 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 4-[2-[(4R)-7-methoxy-4-methyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]ethyl]aniline |
| SMILES | COc1ccc2c(c1)C[C@@H](C)N(CCc1ccc(N)cc1)CC2 |
| InChI | InChI=1S/C20H26N2O/c1-15-13-18-14-20(23-2)8-5-17(18)10-12-22(15)11-9-16-3-6-19(21)7-4-16/h3-8,14-15H,9-13,21H2,1-2H3/t15-/m1/s1 |
| InChIKey | GNCHTURXQMPGMG-OAHLLOKOSA-N |
| XLogP | 3.31 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|