About 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one
8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one (PubChem CID 162648090) has the molecular formula C24H29ClN4O2
and a molecular weight of 440.98 g/mol. Its IUPAC name is 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one.
Molecular Properties
| Compound Name | 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one |
| PubChem CID | 162648090 |
| Molecular Formula | C24H29ClN4O2 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one |
| SMILES | COc1ccc2c(c1)c1c(c(=O)n2CCN(C)C)c2cc(Cl)ccc2n1CCN(C)C |
| InChI | InChI=1S/C24H29ClN4O2/c1-26(2)10-12-28-20-8-6-16(25)14-18(20)22-23(28)19-15-17(31-5)7-9-21(19)29(24(22)30)13-11-27(3)4/h6-9,14-15H,10-13H2,1-5H3 |
| InChIKey | OHROAEQAFDAKHB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one?
The IUPAC name of 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one (CID 162648090) is 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one.
What is the SMILES notation for 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one?
The canonical SMILES for 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one is COc1ccc2c(c1)c1c(c(=O)n2CCN(C)C)c2cc(Cl)ccc2n1CCN(C)C.
What is the InChIKey of 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one?
The InChIKey is OHROAEQAFDAKHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29ClN4O2/c1-26(2)10-12-28-20-8-6-16(25)14-18(20)22-23(28)19-15-17(31-5)7-9-21(19)29(24(22)30)13-11-27(3)4/h6-9,14-15H,10-13H2,1-5H3.
What are the key properties of 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one?
8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one has a molecular weight of 440.98 g/mol, XLogP of 3.89, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5,11-bis[2-(dimethylamino)ethyl]-2-methoxyindolo[3,2-c]quinolin-6-one is sourced from PubChem (CID 162648090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).