C23H26N4O2 — CID 162648364
N-[4-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]phenyl]cyclohexanecarboxamide (PubChem CID 162648364) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[4-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 162648364 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[4-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccc(CCNc2n[nH]c(=O)c3ccccc23)cc1)C1CCCCC1 |
| InChI | InChI=1S/C23H26N4O2/c28-22(17-6-2-1-3-7-17)25-18-12-10-16(11-13-18)14-15-24-21-19-8-4-5-9-20(19)23(29)27-26-21/h4-5,8-13,17H,1-3,6-7,14-15H2,(H,24,26)(H,25,28)(H,27,29) |
| InChIKey | LEHQLXHISVZEME-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |