C20H25N5O3 — CID 162648616
5-amino-3-(2-ethoxyquinolin-6-yl)-1-(4-hydroxy-2-methylbutan-2-yl)pyrazole-4-carboxamide (PubChem CID 162648616) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 5-amino-3-(2-ethoxyquinolin-6-yl)-1-(4-hydroxy-2-methylbutan-2-yl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-(2-ethoxyquinolin-6-yl)-1-(4-hydroxy-2-methylbutan-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162648616 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 5-amino-3-(2-ethoxyquinolin-6-yl)-1-(4-hydroxy-2-methylbutan-2-yl)pyrazole-4-carboxamide |
| SMILES | CCOc1ccc2cc(-c3nn(C(C)(C)CCO)c(N)c3C(N)=O)ccc2n1 |
| InChI | InChI=1S/C20H25N5O3/c1-4-28-15-8-6-12-11-13(5-7-14(12)23-15)17-16(19(22)27)18(21)25(24-17)20(2,3)9-10-26/h5-8,11,26H,4,9-10,21H2,1-3H3,(H2,22,27) |
| InChIKey | NXJKCPWQVKHHLF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |