C18H18F3N5O2 — CID 86342114
5-amino-1-tert-butyl-3-[7-(trifluoromethoxy)quinolin-3-yl]pyrazole-4-carboxamide (PubChem CID 86342114) has the molecular formula C18H18F3N5O2 and a molecular weight of 393.37 g/mol. Its IUPAC name is 5-amino-1-tert-butyl-3-[7-(trifluoromethoxy)quinolin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-tert-butyl-3-[7-(trifluoromethoxy)quinolin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86342114 |
| Molecular Formula | C18H18F3N5O2 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 5-amino-1-tert-butyl-3-[7-(trifluoromethoxy)quinolin-3-yl]pyrazole-4-carboxamide |
| SMILES | CC(C)(C)n1nc(-c2cnc3cc(OC(F)(F)F)ccc3c2)c(C(N)=O)c1N |
| InChI | InChI=1S/C18H18F3N5O2/c1-17(2,3)26-15(22)13(16(23)27)14(25-26)10-6-9-4-5-11(28-18(19,20)21)7-12(9)24-8-10/h4-8H,22H2,1-3H3,(H2,23,27) |
| InChIKey | YJMHWCFTOAMRPN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |